CAS 1142192-43-5

N-[2-Methoxy-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide

Description:

N-[2-Methoxy-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a methoxy group and a trimethylsilyl group. This compound features a dimethylpropanamide moiety, contributing to its amide functional group characteristics. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. The methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. This compound may exhibit specific pharmacological activities, although detailed biological data would be necessary to ascertain its potential applications in medicinal chemistry. Its unique structural features suggest it could be of interest in the development of pharmaceuticals or agrochemicals. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₂₄N₂O₂Si

InChI: InChI=1S/C14H24N2O2Si/c1-14(2,3)13(17)16-11-10(19(5,6)7)8-9-15-12(11)18-4/h8-9H,1-7H3,(H,16,17)

InChI key: InChIKey=BOCMURIOZJRFDW-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C=1C([Si](C)(C)C)=CC=NC1OC

Synonyms:

• N-[2-Methoxy-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide
• Propanamide, N-[2-methoxy-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethyl-
• N-(2-Methoxy-4-(trimethylsilyl)pyridin-3-yl)-pivalamide