CymitQuimica logo

CAS 1142192-44-6

:

N-(4-Formyl-2-methoxy-3-pyridinyl)-2,2-dimethylpropanamide

Description:
N-(4-Formyl-2-methoxy-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a formyl group and a methoxy group, alongside a dimethylpropanamide moiety. This compound is likely to exhibit properties typical of amides, such as moderate polarity and the ability to engage in hydrogen bonding due to the presence of the amide functional group. The methoxy group can influence the compound's solubility and reactivity, while the formyl group may participate in further chemical transformations. The presence of the pyridine ring suggests potential biological activity, as many pyridine derivatives are known for their pharmacological properties. Additionally, the steric hindrance introduced by the dimethyl groups may affect the compound's reactivity and interaction with biological targets. Overall, this compound's characteristics make it of interest in both synthetic chemistry and potential medicinal applications, although specific biological or physical properties would require empirical investigation.
Formula:C12H16N2O3
InChI:InChI=1S/C12H16N2O3/c1-12(2,3)11(16)14-9-8(7-15)5-6-13-10(9)17-4/h5-7H,1-4H3,(H,14,16)
InChI key:InChIKey=HAIPFFCWCGBBOD-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C(C=O)=CC=NC1OC
Synonyms:
  • N-(4-Formyl-2-methoxy-3-pyridinyl)-2,2-dimethylpropanamide
  • Propanamide, N-(4-formyl-2-methoxy-3-pyridinyl)-2,2-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.