CymitQuimica logo

CAS 1142192-49-1

:

N-(2-Iodo-3-methoxy-4-pyridinyl)-2,2-dimethylpropanamide

Description:
N-(2-Iodo-3-methoxy-4-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with an iodine atom and a methoxy group, alongside a branched amide functional group. The presence of the iodine atom contributes to its potential reactivity and biological activity, while the methoxy group can influence its solubility and interaction with biological targets. The 2,2-dimethylpropanamide moiety provides steric hindrance, which may affect the compound's binding properties and overall pharmacokinetics. This compound may exhibit specific properties such as lipophilicity, which can impact its absorption and distribution in biological systems. Additionally, the presence of heteroatoms and functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the combination of these structural elements makes N-(2-Iodo-3-methoxy-4-pyridinyl)-2,2-dimethylpropanamide a compound of interest for further research in various chemical and biological contexts.
Formula:C11H15IN2O2
InChI:InChI=1S/C11H15IN2O2/c1-11(2,3)10(15)14-7-5-6-13-9(12)8(7)16-4/h5-6H,1-4H3,(H,13,14,15)
InChI key:InChIKey=HEOFKBIGTLFGBD-UHFFFAOYSA-N
SMILES:O(C)C=1C(NC(C(C)(C)C)=O)=CC=NC1I
Synonyms:
  • N-(2-Iodo-3-methoxy-4-pyridinyl)-2,2-dimethylpropanamide
  • Propanamide, N-(2-iodo-3-methoxy-4-pyridinyl)-2,2-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.