CAS 1142192-61-7

6-Chlorofuro[3,2-b]pyridine

Description:

6-Chlorofuro[3,2-b]pyridine is a heterocyclic compound characterized by its fused furan and pyridine rings, with a chlorine substituent at the 6-position of the pyridine moiety. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure contributes to its potential reactivity, particularly in electrophilic substitution reactions due to the presence of the electron-withdrawing chlorine atom. The compound may also display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its unique structure allows for various synthetic modifications, which can lead to derivatives with enhanced properties. As with many heterocycles, it may participate in coordination chemistry, forming complexes with metal ions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Chlorofuro[3,2-b]pyridine is a valuable compound in both research and industrial applications, particularly in the fields of organic synthesis and pharmaceuticals.

Formula: C₇H₄ClNO

InChI: InChI=1S/C7H4ClNO/c8-5-3-7-6(9-4-5)1-2-10-7/h1-4H

InChI key: InChIKey=JVLOPJUYEYEQIA-UHFFFAOYSA-N

SMILES: ClC=1C=C2C(=NC1)C=CO2

Synonyms:

• Furo[3,2-b]pyridine, 6-chloro-
• 6-Chlorofuro[3,2-b]pyridine

Furo[3,2-b]pyridine, 6-chloro-

CAS: 1142192-61-7

Formula: C₇H₄ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.5658

Ref: IN-DA000AUJ