CAS 1142192-62-8

2,2-Dimethyl-N-[2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]propanamide

Description:

2,2-Dimethyl-N-[2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]propanamide is a synthetic organic compound characterized by its complex structure, which includes a furo[3,2-b]pyridine moiety and a trimethylsilyl group. This compound features a propanamide functional group, indicating it possesses both amide and alkyl characteristics. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various chemical applications, including medicinal chemistry and material science. The furo[3,2-b]pyridine structure contributes to its potential biological activity, as many compounds with similar frameworks exhibit interesting pharmacological properties. Additionally, the dimethyl substitution on the propanamide backbone may influence its steric and electronic properties, affecting its reactivity and interaction with biological targets. Overall, this compound exemplifies the intricate design often found in modern synthetic chemistry, where specific functional groups are tailored for desired properties and activities.

Formula: C₁₅H₂₂N₂O₂Si

InChI: InChI=1S/C15H22N2O2Si/c1-15(2,3)14(18)17-10-7-8-16-11-9-12(19-13(10)11)20(4,5)6/h7-9H,1-6H3,(H,16,17,18)

InChI key: InChIKey=FWOPZJYMLLPQNR-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C2C(C=C([Si](C)(C)C)O2)=NC=C1

Synonyms:

• Propanamide, 2,2-dimethyl-N-[2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]-
• 2,2-Dimethyl-N-[2-(trimethylsilyl)furo[3,2-b]pyridin-7-yl]propanamide