CAS 1142194-13-5

4-Bromo-2-(2-methylphenyl)pyridine

Description:

4-Bromo-2-(2-methylphenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a 2-methylphenyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. It is often used in organic synthesis and medicinal chemistry, potentially serving as an intermediate in the production of pharmaceuticals or agrochemicals. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions, making it a valuable building block in synthetic chemistry. Additionally, the compound's structure suggests potential biological activity, which may warrant further investigation in drug development contexts. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₂H₁₀BrN

InChI: InChI=1S/C12H10BrN/c1-9-4-2-3-5-11(9)12-8-10(13)6-7-14-12/h2-8H,1H3

InChI key: InChIKey=YEFCJSMKAZPFOH-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(Br)=CC=N2)C=CC=C1

Synonyms:

• 4-Bromo-2-(2-methylphenyl)pyridine
• Pyridine, 4-bromo-2-(2-methylphenyl)-