CAS 1142194-16-8

4-Bromo-2-(3-methylphenyl)pyridine

Description:

4-Bromo-2-(3-methylphenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a 3-methylphenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic groups, which can influence its solubility in organic solvents. It may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions, owing to the electron-withdrawing nature of the bromine substituent. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as derivatives of pyridine are often found in biologically active compounds. Additionally, its molecular interactions can be studied using techniques such as NMR spectroscopy and mass spectrometry, which can provide insights into its behavior in different chemical environments. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₁₂H₁₀BrN

InChI: InChI=1S/C12H10BrN/c1-9-3-2-4-10(7-9)12-8-11(13)5-6-14-12/h2-8H,1H3

InChI key: InChIKey=YYEJJMXSFBQBIP-UHFFFAOYSA-N

SMILES: CC=1C=C(C=CC1)C2=CC(Br)=CC=N2

Synonyms:

• 4-Bromo-2-(3-methylphenyl)pyridine
• Pyridine, 4-bromo-2-(3-methylphenyl)-