CAS 1142194-32-8

4-Bromo-2-(2-methyl-1H-imidazol-1-yl)pyridine

Description:

4-Bromo-2-(2-methyl-1H-imidazol-1-yl)pyridine is a heterocyclic organic compound characterized by the presence of both a bromine atom and an imidazole ring attached to a pyridine backbone. The molecular structure features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and an imidazole ring, a five-membered ring with two nitrogen atoms. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its bromine substituent can enhance reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the imidazole moiety may impart biological activity, potentially making it relevant in pharmaceutical applications. Additionally, the compound's unique structure may influence its electronic properties, such as its ability to participate in coordination chemistry. Overall, 4-Bromo-2-(2-methyl-1H-imidazol-1-yl)pyridine is of interest in both synthetic organic chemistry and medicinal chemistry due to its diverse functional groups and potential applications.

Formula: C₉H₈BrN₃

InChI: InChI=1S/C9H8BrN3/c1-7-11-4-5-13(7)9-6-8(10)2-3-12-9/h2-6H,1H3

InChI key: InChIKey=VHPUDKRBCGPDJQ-UHFFFAOYSA-N

SMILES: CC=1N(C2=CC(Br)=CC=N2)C=CN1

Synonyms:

• 4-Bromo-2-(2-methyl-1H-imidazol-1-yl)pyridine
• Pyridine, 4-bromo-2-(2-methyl-1H-imidazol-1-yl)-