CymitQuimica logo

CAS 1142194-33-9

:

4-Bromo-2-(4-methyl-1H-imidazol-1-yl)pyridine

Description:
4-Bromo-2-(4-methyl-1H-imidazol-1-yl)pyridine is a heterocyclic organic compound characterized by the presence of both a bromine atom and an imidazole ring attached to a pyridine backbone. The molecular structure features a pyridine ring substituted at the 2-position with a 4-methyl-1H-imidazole moiety, which contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its bromine substituent can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions, making it useful in synthetic organic chemistry. The imidazole group can also engage in hydrogen bonding and coordination with metal ions, enhancing its potential applications in medicinal chemistry and material science. Overall, 4-Bromo-2-(4-methyl-1H-imidazol-1-yl)pyridine is of interest for its biological activity and utility in the development of pharmaceuticals and agrochemicals.
Formula:C9H8BrN3
InChI:InChI=1S/C9H8BrN3/c1-7-5-13(6-12-7)9-4-8(10)2-3-11-9/h2-6H,1H3
InChI key:InChIKey=OMRXBDUPASVZQU-UHFFFAOYSA-N
SMILES:BrC=1C=C(N=CC1)N2C=NC(C)=C2
Synonyms:
  • 4-Bromo-2-(4-methyl-1H-imidazol-1-yl)pyridine
  • Pyridine, 4-bromo-2-(4-methyl-1H-imidazol-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.