
CAS 1142194-41-9
:4-Bromo-2-(2-methyl-1-piperidinyl)pyridine
Description:
4-Bromo-2-(2-methyl-1-piperidinyl)pyridine is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with a bromine atom and a piperidine moiety. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential applications in medicinal chemistry. The piperidine group, which is a six-membered ring containing one nitrogen atom, contributes to the compound's basicity and can enhance its interaction with biological targets. This compound may exhibit properties such as lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the specific arrangement of substituents can lead to unique pharmacological activities, making it of interest in drug development. Its CAS number, 1142194-41-9, allows for precise identification in chemical databases and literature. Overall, 4-Bromo-2-(2-methyl-1-piperidinyl)pyridine is a compound with potential applications in various fields, particularly in the development of pharmaceuticals.
Formula:C11H15BrN2
InChI:InChI=1S/C11H15BrN2/c1-9-4-2-3-7-14(9)11-8-10(12)5-6-13-11/h5-6,8-9H,2-4,7H2,1H3
InChI key:InChIKey=DVCKSBNAXKIJGG-UHFFFAOYSA-N
SMILES:CC1N(C2=CC(Br)=CC=N2)CCCC1
Synonyms:- 4-Bromo-2-(2-methyl-1-piperidinyl)pyridine
- Pyridine, 4-bromo-2-(2-methyl-1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.