CAS 1142194-43-1

4-Bromo-2-(3-methyl-1-piperidinyl)pyridine

Description:

4-Bromo-2-(3-methyl-1-piperidinyl)pyridine is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with a bromine atom and a piperidine moiety. The presence of the bromine atom introduces significant polarity and can influence the compound's reactivity and solubility. The piperidine group, which is a six-membered nitrogen-containing ring, contributes to the compound's basicity and potential interactions with biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in areas such as neuropharmacology or as a building block in organic synthesis. Additionally, the compound's characteristics, including its melting point, boiling point, and solubility, would be influenced by the specific functional groups and their arrangement within the molecule. As with many organic compounds, safety and handling precautions are essential due to the presence of bromine, which can be hazardous.

Formula: C₁₁H₁₅BrN₂

InChI: InChI=1S/C11H15BrN2/c1-9-3-2-6-14(8-9)11-7-10(12)4-5-13-11/h4-5,7,9H,2-3,6,8H2,1H3

InChI key: InChIKey=YTKJJFUDLFGEFQ-UHFFFAOYSA-N

SMILES: BrC=1C=C(N=CC1)N2CC(C)CCC2

Synonyms:

• 4-Bromo-2-(3-methyl-1-piperidinyl)pyridine
• Pyridine, 4-bromo-2-(3-methyl-1-piperidinyl)-