CymitQuimica logo

CAS 1142194-51-1

:

4-Bromo-2-(cyclobutyloxy)pyridine

Description:
4-Bromo-2-(cyclobutyloxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a cyclobutyloxy group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar and non-polar functional groups. The bromine substituent can enhance reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The cyclobutyloxy group introduces a cyclic ether functionality, which can influence the compound's steric and electronic properties. Additionally, 4-Bromo-2-(cyclobutyloxy)pyridine may have applications in medicinal chemistry and material science, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c10-7-4-5-11-9(6-7)12-8-2-1-3-8/h4-6,8H,1-3H2
InChI key:InChIKey=YEEMCNZWYCOAFW-UHFFFAOYSA-N
SMILES:O(C1=CC(Br)=CC=N1)C2CCC2
Synonyms:
  • Pyridine, 4-bromo-2-(cyclobutyloxy)-
  • 4-Bromo-2-(cyclobutyloxy)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.