CymitQuimica logo

CAS 1142194-54-4

:

4-Bromo-2-(cyclohexyloxy)pyridine

Description:
4-Bromo-2-(cyclohexyloxy)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a cyclohexyloxy group and at the 4-position with a bromine atom. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its non-polar characteristics due to the cyclohexyl group. The presence of the bromine atom introduces halogen reactivity, which can be exploited in various chemical reactions, such as nucleophilic substitutions. The cyclohexyloxy group contributes to the compound's hydrophobic properties, influencing its interactions in biological systems and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be investigated further in drug development studies. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H14BrNO
InChI:InChI=1S/C11H14BrNO/c12-9-6-7-13-11(8-9)14-10-4-2-1-3-5-10/h6-8,10H,1-5H2
InChI key:InChIKey=AICBQLOVWLTKAG-UHFFFAOYSA-N
SMILES:O(C1=CC(Br)=CC=N1)C2CCCCC2
Synonyms:
  • 4-Bromo-2-(cyclohexyloxy)pyridine
  • Pyridine, 4-bromo-2-(cyclohexyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.