CAS 1142194-55-5
:4-Bromo-2-[(tetrahydro-3-furanyl)oxy]pyridine
Description:
4-Bromo-2-[(tetrahydro-3-furanyl)oxy]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and polarity. The tetrahydro-3-furanyl group, attached via an ether linkage at the 2-position, contributes to the compound's overall structure and may affect its solubility and interaction with biological systems. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the furanyl moiety, which can enhance its ability to permeate biological membranes. Additionally, the bromine substituent may impart unique electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 4-Bromo-2-[(tetrahydro-3-furanyl)oxy]pyridine presents interesting characteristics that could be explored in medicinal chemistry and material science applications.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c10-7-1-3-11-9(5-7)13-8-2-4-12-6-8/h1,3,5,8H,2,4,6H2
InChI key:InChIKey=MLHDTCLHTVTXCI-UHFFFAOYSA-N
SMILES:O(C1=CC(Br)=CC=N1)C2CCOC2
Synonyms:- 4-Bromo-2-[(tetrahydro-3-furanyl)oxy]pyridine
- Pyridine, 4-bromo-2-[(tetrahydro-3-furanyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
