CymitQuimica logo

CAS 1142195-71-8

:

4-Bromo-2-(2-methylpropyl)pyrimidine

Description:
4-Bromo-2-(2-methylpropyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 4-position and a branched alkyl group, specifically a 2-methylpropyl group at the 2-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential reactivity in nucleophilic substitution reactions due to the presence of the bromine atom, which can serve as a leaving group. Additionally, the branched alkyl substituent may influence its steric properties and overall reactivity. 4-Bromo-2-(2-methylpropyl)pyrimidine may find applications in medicinal chemistry and material science, particularly in the synthesis of pharmaceuticals or agrochemicals, owing to the biological activity often associated with pyrimidine derivatives.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c1-6(2)5-8-10-4-3-7(9)11-8/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=BQWPFCWSAYYGEY-UHFFFAOYSA-N
SMILES:C(C(C)C)C=1N=C(Br)C=CN1
Synonyms:
  • 4-Bromo-2-(2-methylpropyl)pyrimidine
  • Pyrimidine, 4-bromo-2-(2-methylpropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.