CymitQuimica logo

CAS 1142196-38-0

:

4-Bromo-2-(4-fluorophenyl)thiazole

Description:
4-Bromo-2-(4-fluorophenyl)thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom at the 4-position and a para-fluorophenyl group at the 2-position of the thiazole ring, contributing to its unique chemical properties. This substitution pattern can influence its reactivity, solubility, and biological activity. Generally, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of halogens, such as bromine and fluorine, often enhances lipophilicity and can affect the compound's interaction with biological targets. Additionally, thiazole derivatives are known for their diverse applications, including use as agrochemicals, pharmaceuticals, and in materials science. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values.
Formula:C9H5BrFNS
InChI:InChI=1S/C9H5BrFNS/c10-8-5-13-9(12-8)6-1-3-7(11)4-2-6/h1-5H
InChI key:InChIKey=QYQFXTPEZJYBSM-UHFFFAOYSA-N
SMILES:BrC=1N=C(C2=CC=C(F)C=C2)SC1
Synonyms:
  • 4-Bromo-2-(4-fluorophenyl)thiazole
  • Thiazole, 4-bromo-2-(4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.