CAS 1142198-19-3
:Ethyl 1-(aminocarbonyl)cyclobutanecarboxylate
Description:
Ethyl 1-(aminocarbonyl)cyclobutanecarboxylate is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and an ethyl ester functional group. This compound features an aminocarbonyl group, indicating the presence of an amine and a carbonyl group, which contributes to its reactivity and potential biological activity. The cyclobutane ring provides a rigid framework that can influence the compound's conformational properties and interactions with other molecules. Ethyl 1-(aminocarbonyl)cyclobutanecarboxylate may exhibit solubility in organic solvents, and its reactivity can be attributed to the presence of functional groups that can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. This compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or applications would require further investigation. Overall, its structural features suggest potential utility in various chemical contexts, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C8H13NO3
InChI:InChI=1S/C8H13NO3/c1-2-12-7(11)8(6(9)10)4-3-5-8/h2-5H2,1H3,(H2,9,10)
InChI key:InChIKey=XJENSZIDXWFFGW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(C(N)=O)CCC1
Synonyms:- Cyclobutanecarboxylic acid, 1-(aminocarbonyl)-, ethyl ester
- Ethyl 1-(aminocarbonyl)cyclobutanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
