CymitQuimica logo

CAS 1142198-88-6

:

4-[(2-Chloro-6-fluorophenyl)methylene]-3-(chloromethyl)-5(4H)-isoxazolone

Description:
4-[(2-Chloro-6-fluorophenyl)methylene]-3-(chloromethyl)-5(4H)-isoxazolone, identified by its CAS number 1142198-88-6, is a synthetic organic compound characterized by its isoxazolone core, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound exhibits a complex structure with multiple functional groups, including a chloromethyl group and a chloro-fluorophenyl moiety, contributing to its potential reactivity and biological activity. Isoxazolones are known for their diverse applications in medicinal chemistry, often serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. The presence of halogen substituents, such as chlorine and fluorine, can enhance the lipophilicity and biological activity of the compound, making it of interest in drug development. Additionally, the compound's unique structural features may influence its solubility, stability, and interaction with biological targets. Overall, this substance represents a class of compounds that may possess significant pharmacological properties, warranting further investigation into its potential applications.
Formula:C11H6Cl2FNO2
InChI:InChI=1S/C11H6Cl2FNO2/c12-5-10-7(11(16)17-15-10)4-6-8(13)2-1-3-9(6)14/h1-4H,5H2
InChI key:InChIKey=OAPIAYBPRPBRLS-UHFFFAOYSA-N
SMILES:C(=C1C(CCl)=NOC1=O)C2=C(Cl)C=CC=C2F
Synonyms:
  • 4-[(2-Chloro-6-fluorophenyl)methylene]-3-(chloromethyl)-5(4H)-isoxazolone
  • 5(4H)-Isoxazolone, 4-[(2-chloro-6-fluorophenyl)methylene]-3-(chloromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.