CAS 1142199-13-0: 3-(Chloromethyl)-4-[(2-methoxyphenyl)methylene]-5(4H)-isoxazolone

Description: 3-(Chloromethyl)-4-[(2-methoxyphenyl)methylene]-5(4H)-isoxazolone is a synthetic organic compound characterized by its unique isoxazolone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of a chloromethyl group enhances its reactivity, making it a potential intermediate in various chemical syntheses. The methylene bridge connecting the isoxazolone to a 2-methoxyphenyl group contributes to its stability and solubility in organic solvents. This compound may exhibit biological activity, which can be attributed to the isoxazolone moiety, known for its diverse pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's reactivity can be exploited in further chemical transformations, making it a valuable building block in organic synthesis. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of the chloromethyl group, which can pose hazards.

Formula: C₁₂H₁₀ClNO₃

InChI: InChI=1S/C12H10ClNO3/c1-16-11-5-3-2-4-8(11)6-9-10(7-13)14-17-12(9)15/h2-6H,7H2,1H3

InChI key: InChIKey=OMNWTSVIAZVNDE-UHFFFAOYSA-N

SMILES: O=C1ON=C(C1=CC=2C=CC=CC2OC)CCl

(4E)-3-(chloromethyl)-4-(2-methoxybenzylidene)isoxazol-5(4H)-one

CAS: 1142199-13-0

• Molecular weight: 251.6699981689453

(4E)-3-(Chloromethyl)-4-(2-methoxybenzylidene)isoxazol-5(4H)-one

CAS: 1142199-13-0

Please enquire for more information about (4E)-3-(Chloromethyl)-4-(2-methoxybenzylidene)isoxazol-5(4H)-one including the price, delivery time and more detailed …

• Formula: C₁₂H₁₀ClNO₃
• Purity: Min. 95%
• Molecular weight: 251.67 g/mol