CAS 1142199-23-2
:3-(Chloromethyl)-4-[(4-fluorophenyl)methylene]-5(4H)-isoxazolone
Description:
3-(Chloromethyl)-4-[(4-fluorophenyl)methylene]-5(4H)-isoxazolone is a synthetic organic compound characterized by its unique isoxazolone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of a chloromethyl group enhances its reactivity, making it a potential intermediate in various chemical syntheses. The compound also contains a 4-fluorophenyl group, which can influence its electronic properties and biological activity. Isoxazolones are known for their diverse applications, including use in pharmaceuticals, agrochemicals, and as building blocks in organic synthesis. The specific arrangement of substituents in this compound may impart unique characteristics, such as solubility in organic solvents and potential interactions with biological targets. Its molecular structure suggests that it may exhibit interesting pharmacological properties, warranting further investigation in medicinal chemistry. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.
Formula:C11H7ClFNO2
InChI:InChI=1S/C11H7ClFNO2/c12-6-10-9(11(15)16-14-10)5-7-1-3-8(13)4-2-7/h1-5H,6H2
InChI key:InChIKey=IPXJUQIZUGXVTC-UHFFFAOYSA-N
SMILES:C(=C1C(CCl)=NOC1=O)C2=CC=C(F)C=C2
Synonyms:- 5(4H)-Isoxazolone, 3-(chloromethyl)-4-[(4-fluorophenyl)methylene]-
- 3-(Chloromethyl)-4-[(4-fluorophenyl)methylene]-5(4H)-isoxazolone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.