CAS 1142199-29-8
:3-(Chloromethyl)-4-(1-naphthalenylmethylene)-5(4H)-isoxazolone
Description:
3-(Chloromethyl)-4-(1-naphthalenylmethylene)-5(4H)-isoxazolone, identified by its CAS number 1142199-29-8, is a synthetic organic compound characterized by its isoxazolone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound exhibits a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of the naphthalenylmethylene moiety contributes to its aromatic character, potentially influencing its electronic properties and interactions with other molecules. Isoxazolones are known for their biological activity, and this particular compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions, which are critical for applications in research and development. Overall, the unique structural features of this compound suggest potential utility in various chemical and pharmaceutical applications, warranting further investigation into its properties and behavior in different contexts.
Formula:C15H10ClNO2
InChI:InChI=1S/C15H10ClNO2/c16-9-14-13(15(18)19-17-14)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-8H,9H2
InChI key:InChIKey=PJGVNYJCKSIYRM-UHFFFAOYSA-N
SMILES:C(C=1C2=C(C=CC1)C=CC=C2)=C3C(CCl)=NOC3=O
Synonyms:- 5(4H)-Isoxazolone, 3-(chloromethyl)-4-(1-naphthalenylmethylene)-
- 3-(Chloromethyl)-4-(1-naphthalenylmethylene)-5(4H)-isoxazolone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.