CAS 1142199-54-9
:4-[(4-Bromophenyl)methylene]-3-(chloromethyl)-5(4H)-isoxazolone
Description:
4-[(4-Bromophenyl)methylene]-3-(chloromethyl)-5(4H)-isoxazolone is a synthetic organic compound characterized by its isoxazolone core, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound exhibits a unique structure due to the presence of a bromophenyl group and a chloromethyl substituent, contributing to its potential reactivity and biological activity. The bromine atom can enhance lipophilicity and influence the compound's interaction with biological targets, while the chloromethyl group may serve as a reactive site for further chemical modifications. Isoxazolones are known for their diverse applications, including in pharmaceuticals and agrochemicals, often exhibiting antimicrobial and anti-inflammatory properties. The compound's specific properties, such as solubility, melting point, and stability, would depend on its molecular interactions and the presence of functional groups. Overall, this compound represents a class of heterocyclic compounds with potential utility in various chemical and biological applications.
Formula:C11H7BrClNO2
InChI:InChI=1S/C11H7BrClNO2/c12-8-3-1-7(2-4-8)5-9-10(6-13)14-16-11(9)15/h1-5H,6H2
InChI key:InChIKey=MYOCDYHBEOIULH-UHFFFAOYSA-N
SMILES:C(=C1C(CCl)=NOC1=O)C2=CC=C(Br)C=C2
Synonyms:- 4-[(4-Bromophenyl)methylene]-3-(chloromethyl)-5(4H)-isoxazolone
- 5(4H)-Isoxazolone, 4-[(4-bromophenyl)methylene]-3-(chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.