
CAS 1142199-73-2
:3-(Chloromethyl)-4-(2-pyridinylmethylene)-5(4H)-isoxazolone
Description:
3-(Chloromethyl)-4-(2-pyridinylmethylene)-5(4H)-isoxazolone, identified by its CAS number 1142199-73-2, is a chemical compound that features a unique isoxazolone ring structure, which is characterized by a five-membered ring containing both nitrogen and oxygen atoms. This compound includes a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of a pyridinylmethylene substituent indicates that it has aromatic characteristics, contributing to its stability and potential biological activity. Isoxazolones are known for their diverse applications, including in pharmaceuticals and agrochemicals, due to their ability to interact with biological systems. The compound's specific properties, such as solubility, melting point, and reactivity, would depend on its molecular structure and the functional groups present. Overall, this compound represents a class of heterocyclic compounds that may exhibit interesting chemical behavior and potential applications in various fields of research.
Formula:C10H7ClN2O2
InChI:InChI=1S/C10H7ClN2O2/c11-6-9-8(10(14)15-13-9)5-7-3-1-2-4-12-7/h1-5H,6H2
InChI key:InChIKey=GNBAXRVRVCMWTJ-UHFFFAOYSA-N
SMILES:C(=C1C(CCl)=NOC1=O)C2=CC=CC=N2
Synonyms:- 5(4H)-Isoxazolone, 3-(chloromethyl)-4-(2-pyridinylmethylene)-
- 3-(Chloromethyl)-4-(2-pyridinylmethylene)-5(4H)-isoxazolone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.