CymitQuimica logo

CAS 1142199-96-9

:

5-(5-Methyl-2-furanyl)-1,2,4-triazine-3(2H)-thione

Description:
5-(5-Methyl-2-furanyl)-1,2,4-triazine-3(2H)-thione is a heterocyclic compound characterized by the presence of a triazine ring, which is a six-membered ring containing three nitrogen atoms and three carbon atoms. The compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the triazine structure. The 5-methyl-2-furanyl substituent introduces a furan ring, which is a five-membered aromatic ring containing one oxygen atom, contributing to the compound's overall reactivity and potential biological activity. This compound may exhibit properties such as antioxidant activity, and its unique structure suggests potential applications in pharmaceuticals or agrochemicals. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many heterocycles, the electronic properties imparted by the nitrogen and sulfur atoms can influence its interaction with biological targets, making it a subject of interest in medicinal chemistry and material science.
Formula:C8H7N3OS
InChI:InChI=1S/C8H7N3OS/c1-5-2-3-7(12-5)6-4-9-11-8(13)10-6/h2-4H,1H3,(H,10,11,13)
InChI key:InChIKey=UYPCCAIIANXIQH-UHFFFAOYSA-N
SMILES:S=C1NC(=CN=N1)C2=CC=C(C)O2
Synonyms:
  • 5-(5-Methyl-2-furanyl)-1,2,4-triazine-3(2H)-thione
  • 1,2,4-Triazine-3(2H)-thione, 5-(5-methyl-2-furanyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.