CymitQuimica logo

CAS 1142200-43-8

:

N-(4-Nitrophenyl)-4-oxo-2-thioxo-5-thiazolidineacetamide

Description:
N-(4-Nitrophenyl)-4-oxo-2-thioxo-5-thiazolidineacetamide is a chemical compound characterized by its thiazolidine ring structure, which incorporates both a thione and an amide functional group. This compound features a nitrophenyl substituent, contributing to its potential reactivity and biological activity. The presence of the 4-oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. The thiazolidine framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the nitro group may enhance the compound's electronic properties, influencing its solubility and reactivity. Overall, this compound's unique structural features may confer specific properties that could be explored for therapeutic applications or as intermediates in organic synthesis. However, detailed studies would be necessary to fully understand its behavior and potential uses in various chemical contexts.
Formula:C11H9N3O4S2
InChI:InChI=1S/C11H9N3O4S2/c15-9(5-8-10(16)13-11(19)20-8)12-6-1-3-7(4-2-6)14(17)18/h1-4,8H,5H2,(H,12,15)(H,13,16,19)
InChI key:InChIKey=KKBQWJQKHIRNOD-UHFFFAOYSA-N
SMILES:C(C(NC1=CC=C(N(=O)=O)C=C1)=O)C2SC(=S)NC2=O
Synonyms:
  • N-(4-Nitrophenyl)-4-oxo-2-thioxo-5-thiazolidineacetamide
  • 5-Thiazolidineacetamide, N-(4-nitrophenyl)-4-oxo-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.