CAS 1142201-19-1

2-[(4-Amino-1,3,5-triazin-2-yl)thio]acetic acid

Description:

2-[(4-Amino-1,3,5-triazin-2-yl)thio]acetic acid, identified by its CAS number 1142201-19-1, is a chemical compound characterized by the presence of a thioether functional group and an amino group attached to a triazine ring. This compound features a carboxylic acid group, which contributes to its acidic properties. The triazine moiety provides stability and potential for various chemical interactions, making it of interest in fields such as agrochemicals and pharmaceuticals. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the thioether linkage may impart unique reactivity and biological activity, potentially influencing its role in biochemical pathways or as a ligand in coordination chemistry. Overall, this compound's structural features suggest it may exhibit interesting properties, including potential applications in drug development or as a biochemical probe. Further studies would be necessary to fully elucidate its behavior and applications in various chemical contexts.

Formula: C₅H₆N₄O₂S

InChI: InChI=1S/C5H6N4O2S/c6-4-7-2-8-5(9-4)12-1-3(10)11/h2H,1H2,(H,10,11)(H2,6,7,8,9)

InChI key: InChIKey=FUMGCWBUHRJMSP-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C=1N=C(N)N=CN1

Synonyms:

• Acetic acid, 2-[(4-amino-1,3,5-triazin-2-yl)thio]-
• 2-[(4-Amino-1,3,5-triazin-2-yl)thio]acetic acid