CAS 1142201-20-4

Methyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate

Description:

Methyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate is a chemical compound characterized by its unique structure, which includes a methyl ester group and a thioether linkage to a triazine ring. The presence of the amino group on the triazine contributes to its potential reactivity and biological activity. This compound may exhibit properties typical of both thioesters and triazines, such as potential herbicidal or fungicidal activity, making it of interest in agricultural chemistry. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the methyl ester functionality may influence its solubility and stability in different solvents. As with many triazine derivatives, it may also be subject to environmental considerations regarding its persistence and degradation. Overall, Methyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate represents a class of compounds that could have applications in both synthetic chemistry and agrochemical formulations.

Formula: C₆H₈N₄O₂S

InChI: InChI=1S/C6H8N4O2S/c1-12-4(11)2-13-6-9-3-8-5(7)10-6/h3H,2H2,1H3,(H2,7,8,9,10)

InChI key: InChIKey=NYVAIFOIPIWXEA-UHFFFAOYSA-N

SMILES: S(CC(OC)=O)C=1N=C(N)N=CN1

Synonyms:

• Acetic acid, 2-[(4-amino-1,3,5-triazin-2-yl)thio]-, methyl ester
• Methyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate