CAS 1142201-33-9
:2-(Ethylthio)-4,5-dihydro-4-oxo-5-thiazoleacetic acid
Description:
2-(Ethylthio)-4,5-dihydro-4-oxo-5-thiazoleacetic acid is a chemical compound characterized by its thiazole ring structure, which incorporates both sulfur and nitrogen atoms. This compound features an ethylthio group, contributing to its unique reactivity and potential biological activity. The presence of the 4-oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The dihydro form suggests that the compound may exhibit specific stereochemical properties, influencing its interactions with biological targets. Additionally, the acetic acid moiety indicates potential acidity, which may affect its solubility and reactivity in different pH environments. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to the development of novel therapeutic agents. Overall, its unique combination of functional groups and structural characteristics makes it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C7H9NO3S2
InChI:InChI=1S/C7H9NO3S2/c1-2-12-7-8-6(11)4(13-7)3-5(9)10/h4H,2-3H2,1H3,(H,9,10)
InChI key:InChIKey=YTOGGNPWISOTTN-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C(=O)N=C(SCC)S1
Synonyms:- 2-(Ethylthio)-4,5-dihydro-4-oxo-5-thiazoleacetic acid
- 5-Thiazoleacetic acid, 2-(ethylthio)-4,5-dihydro-4-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.