CAS 1142201-36-2

4,5-Dihydro-2-[(1-methylethyl)thio]-4-oxo-5-thiazoleacetic acid

Description:

4,5-Dihydro-2-[(1-methylethyl)thio]-4-oxo-5-thiazoleacetic acid is a chemical compound characterized by its thiazole ring structure, which incorporates a thioether functional group and a carboxylic acid moiety. This compound typically exhibits properties associated with thiazole derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the thioether group may enhance its lipophilicity, influencing its solubility and permeability in biological systems. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or cyclization, due to the reactive nature of the thiazole and carboxylic acid functionalities. Additionally, its molecular configuration may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. As with many thiazole derivatives, it may also exhibit stability under standard laboratory conditions, although specific stability data would depend on environmental factors such as pH and temperature. Overall, this compound represents a unique scaffold for further exploration in pharmaceutical applications.

Formula: C₈H₁₁NO₃S₂

InChI: InChI=1S/C8H11NO3S2/c1-4(2)13-8-9-7(12)5(14-8)3-6(10)11/h4-5H,3H2,1-2H3,(H,10,11)

InChI key: InChIKey=LHXKFCDPAQNFAP-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1SC(SC(C)C)=NC1=O

Synonyms:

• 4,5-Dihydro-2-[(1-methylethyl)thio]-4-oxo-5-thiazoleacetic acid
• 5-Thiazoleacetic acid, 4,5-dihydro-2-[(1-methylethyl)thio]-4-oxo-