CymitQuimica logo

CAS 1142201-40-8

:

4,5-Dihydro-4-oxo-2-[(phenylmethyl)thio]-5-thiazoleacetic acid

Description:
4,5-Dihydro-4-oxo-2-[(phenylmethyl)thio]-5-thiazoleacetic acid is a thiazole derivative characterized by its unique structural features, including a thiazole ring and a carboxylic acid functional group. This compound typically exhibits properties associated with thiazole derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the phenylmethylthio group may enhance its lipophilicity, influencing its solubility and bioavailability. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or cyclization, due to the reactive functional groups present. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many thiazole derivatives, it may also exhibit fluorescence properties, making it useful in certain analytical applications. Overall, 4,5-Dihydro-4-oxo-2-[(phenylmethyl)thio]-5-thiazoleacetic acid represents a compound of interest in medicinal chemistry and pharmacology, warranting further investigation into its potential applications and mechanisms of action.
Formula:C12H11NO3S2
InChI:InChI=1S/C12H11NO3S2/c14-10(15)6-9-11(16)13-12(18-9)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,14,15)
InChI key:InChIKey=ZYPCJXUFAPZWOQ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C(=O)N=C(SCC2=CC=CC=C2)S1
Synonyms:
  • 5-Thiazoleacetic acid, 4,5-dihydro-4-oxo-2-[(phenylmethyl)thio]-
  • 4,5-Dihydro-4-oxo-2-[(phenylmethyl)thio]-5-thiazoleacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.