CymitQuimica logo

CAS 1142201-66-8

:

2-Chloro-7-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)quinoline

Description:
2-Chloro-7-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)quinoline is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a chlorine atom and a methyl group, as well as a 1,2,4-oxadiazole moiety. The presence of the chlorine atom at the 2-position and the methyl group at the 7-position of the quinoline ring contributes to its unique reactivity and potential biological activity. The oxadiazole ring, known for its heterocyclic properties, enhances the compound's stability and may impart specific pharmacological effects. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of antimicrobial and anticancer research. Its molecular structure suggests that it may exhibit a range of interactions with biological targets, making it a candidate for further investigation in various therapeutic areas. As with many synthetic compounds, its solubility, stability, and reactivity will depend on the specific conditions under which it is studied.
Formula:C15H14ClN3O
InChI:InChI=1S/C15H14ClN3O/c1-3-4-13-18-15(19-20-13)11-8-10-6-5-9(2)7-12(10)17-14(11)16/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=GRZBMOBOYOMXMP-UHFFFAOYSA-N
SMILES:ClC=1C(=CC2=C(N1)C=C(C)C=C2)C=3N=C(CCC)ON3
Synonyms:
  • 2-Chloro-7-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)quinoline
  • Quinoline, 2-chloro-7-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.