CymitQuimica logo

CAS 1142201-71-5

:

2-Chloro-6-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)quinoline

Description:
2-Chloro-6-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)quinoline is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a chlorine atom and a methyl group, as well as a propyl-substituted oxadiazole moiety. The presence of the chlorine atom at the 2-position and the methyl group at the 6-position of the quinoline ring contributes to its unique reactivity and potential biological activity. The oxadiazole ring, known for its heterocyclic properties, may impart additional pharmacological characteristics, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. The compound's solubility, stability, and reactivity would depend on the functional groups present and the overall electronic distribution within the molecule. As with many heterocyclic compounds, it may exhibit interesting properties such as fluorescence or antimicrobial activity, warranting further investigation in both synthetic and applied chemistry contexts.
Formula:C15H14ClN3O
InChI:InChI=1S/C15H14ClN3O/c1-3-4-13-18-15(19-20-13)11-8-10-7-9(2)5-6-12(10)17-14(11)16/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=LSZVYGYJSYIUPR-UHFFFAOYSA-N
SMILES:ClC=1C(=CC2=C(N1)C=CC(C)=C2)C=3N=C(CCC)ON3
Synonyms:
  • Quinoline, 2-chloro-6-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)-
  • 2-Chloro-6-methyl-3-(5-propyl-1,2,4-oxadiazol-3-yl)quinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.