CAS 1142201-75-9
:2-Chloro-7-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)quinoline
Description:
2-Chloro-7-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)quinoline is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a chlorine atom and a 5-methyl-1,2,4-oxadiazol-3-yl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or antitumor effects, although specific biological data would depend on empirical studies. The presence of the chlorine atom and the oxadiazole moiety can influence its reactivity and solubility, making it of interest in medicinal chemistry and material science. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its stability, solubility, and reactivity would be influenced by the functional groups present, and it may be synthesized through specific organic reactions involving quinoline derivatives and oxadiazole precursors. Overall, 2-Chloro-7-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)quinoline represents a unique compound with potential applications in various fields of chemistry and pharmacology.
Formula:C13H10ClN3O
InChI:InChI=1S/C13H10ClN3O/c1-7-3-4-9-6-10(12(14)16-11(9)5-7)13-15-8(2)18-17-13/h3-6H,1-2H3
InChI key:InChIKey=WEFKDLJOOQZXSF-UHFFFAOYSA-N
SMILES:ClC=1C(=CC2=C(N1)C=C(C)C=C2)C=3N=C(C)ON3
Synonyms:- Quinoline, 2-chloro-7-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)-
- 2-Chloro-7-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)quinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.