CAS 1142201-76-0
:2-Chloro-6-methyl-3-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]quinoline
Description:
2-Chloro-6-methyl-3-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]quinoline is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a chloro and a methyl group, as well as a 1,2,4-oxadiazole moiety. The presence of the chloro group typically enhances the compound's reactivity and may influence its biological activity. The methyl group contributes to the hydrophobic character of the molecule, potentially affecting its solubility and interaction with biological systems. The oxadiazole ring is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. This compound may exhibit unique properties due to the combination of these functional groups, making it of interest in medicinal chemistry and drug development. Its specific applications and biological activities would depend on further empirical studies, including in vitro and in vivo evaluations. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C15H14ClN3O
InChI:InChI=1S/C15H14ClN3O/c1-8(2)15-18-14(19-20-15)11-7-10-6-9(3)4-5-12(10)17-13(11)16/h4-8H,1-3H3
InChI key:InChIKey=VIHRPERXAGGJDX-UHFFFAOYSA-N
SMILES:ClC=1C(=CC2=C(N1)C=CC(C)=C2)C=3N=C(C(C)C)ON3
Synonyms:- 2-Chloro-6-methyl-3-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]quinoline
- Quinoline, 2-chloro-6-methyl-3-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.