CAS 1142201-85-1
:6-Hydroxy-5-(2-hydroxyethyl)-1-methyl-2(1H)-pyrimidinone
Description:
6-Hydroxy-5-(2-hydroxyethyl)-1-methyl-2(1H)-pyrimidinone, with the CAS number 1142201-85-1, is a pyrimidinone derivative characterized by its unique structural features, including a hydroxyl group and a hydroxyethyl substituent. This compound typically exhibits properties associated with heterocyclic organic compounds, such as solubility in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, possibly influencing enzymatic pathways or acting as a pharmaceutical intermediate. The presence of the methyl group may enhance lipophilicity, affecting its interaction with biological membranes. Additionally, the compound may exhibit stability under standard laboratory conditions, although specific reactivity and stability can vary based on environmental factors. Overall, 6-Hydroxy-5-(2-hydroxyethyl)-1-methyl-2(1H)-pyrimidinone represents a class of compounds that could be of interest in medicinal chemistry and biochemistry, warranting further investigation into its potential applications and mechanisms of action.
Formula:C7H10N2O3
InChI:InChI=1S/C7H10N2O3/c1-9-6(11)5(2-3-10)4-8-7(9)12/h4,10-11H,2-3H2,1H3
InChI key:InChIKey=XHBSZXCPGJJOOM-UHFFFAOYSA-N
SMILES:C(CO)C1=C(O)N(C)C(=O)N=C1
Synonyms:- 6-Hydroxy-5-(2-hydroxyethyl)-1-methyl-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 6-hydroxy-5-(2-hydroxyethyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.