CAS 1142201-89-5

2-Bromo-5-methoxy-4-(1-methylethoxy)benzoic acid

Description:

2-Bromo-5-methoxy-4-(1-methylethoxy)benzoic acid is an organic compound characterized by its complex structure, which includes a bromine atom, a methoxy group, and an ethoxy substituent on a benzoic acid framework. This compound features a carboxylic acid functional group, which imparts acidic properties and can participate in various chemical reactions, such as esterification and amidation. The presence of the bromine atom enhances its reactivity, making it a potential candidate for further chemical modifications. The methoxy group contributes to the compound's lipophilicity, influencing its solubility and interaction with biological systems. Additionally, the bulky 1-methylethoxy group may affect the steric hindrance around the reactive sites, impacting its reactivity and potential applications in synthesis or as a pharmaceutical intermediate. Overall, this compound's unique combination of functional groups and substituents makes it of interest in organic synthesis and medicinal chemistry, although specific applications would depend on further research and exploration of its properties.

Formula: C₁₁H₁₃BrO₄

InChI: InChI=1S/C11H13BrO4/c1-6(2)16-10-5-8(12)7(11(13)14)4-9(10)15-3/h4-6H,1-3H3,(H,13,14)

InChI key: InChIKey=JKHMLZVDLVTXHO-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(OC)C=C(C(O)=O)C(Br)=C1

Synonyms:

• 2-Bromo-5-methoxy-4-propan-2-yloxybenzoic acid
• 2-Bromo-5-methoxy-4-(1-methylethoxy)benzoic acid
• 2-Bromo-5-methoxy-4-(propan-2-yloxy)benzoic acid
• 2-Bromo-4-isopropoxy-5-methoxy-benzoic acid
• Benzoic acid, 2-bromo-5-methoxy-4-(1-methylethoxy)-