CAS 1142201-94-2

4-[(2,6-Dichlorophenyl)methoxy]-3-ethoxybenzoic acid

Description:

4-[(2,6-Dichlorophenyl)methoxy]-3-ethoxybenzoic acid, identified by its CAS number 1142201-94-2, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with both an ethoxy group and a methoxy group attached to a dichlorophenyl ring. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of chlorine atoms in the dichlorophenyl group can enhance the compound's lipophilicity and influence its biological activity, making it of interest in pharmaceutical research. Additionally, the ethoxy and methoxy substituents can affect solubility and reactivity, contributing to its potential applications in medicinal chemistry. The compound's molecular interactions may also be influenced by hydrogen bonding capabilities due to the carboxylic acid functional group, which can participate in both donor and acceptor interactions. Overall, this compound's unique structural features suggest potential utility in various chemical and biological applications.

Formula: C₁₆H₁₄Cl₂O₄

InChI: InChI=1S/C16H14Cl2O4/c1-2-21-15-8-10(16(19)20)6-7-14(15)22-9-11-12(17)4-3-5-13(11)18/h3-8H,2,9H2,1H3,(H,19,20)

InChI key: InChIKey=ZUZCCTJGOSZCRR-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1Cl)C2=C(OCC)C=C(C(O)=O)C=C2

Synonyms:

• 4-[(2,6-Dichlorophenyl)methoxy]-3-ethoxybenzoic acid
• Benzoic acid, 4-[(2,6-dichlorophenyl)methoxy]-3-ethoxy-