CymitQuimica logo

CAS 1142201-95-3

:

4-[(2-Chloro-4-fluorophenyl)methoxy]-3-ethoxybenzoic acid

Description:
4-[(2-Chloro-4-fluorophenyl)methoxy]-3-ethoxybenzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with an ethoxy group and a methoxy group linked to a chlorofluorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of halogen atoms, such as chlorine and fluorine, often enhances the compound's biological activity and lipophilicity, making it of interest in pharmaceutical applications. Additionally, the ethoxy and methoxy substituents can influence the compound's polarity and interaction with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the precise molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H14ClFO4
InChI:InChI=1S/C16H14ClFO4/c1-2-21-15-7-10(16(19)20)4-6-14(15)22-9-11-3-5-12(18)8-13(11)17/h3-8H,2,9H2,1H3,(H,19,20)
InChI key:InChIKey=BXCIJVXPFHZBEZ-UHFFFAOYSA-N
SMILES:O(CC1=C(Cl)C=C(F)C=C1)C2=C(OCC)C=C(C(O)=O)C=C2
Synonyms:
  • Benzoic acid, 4-[(2-chloro-4-fluorophenyl)methoxy]-3-ethoxy-
  • 4-[(2-Chloro-4-fluorophenyl)methoxy]-3-ethoxybenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.