CAS 1142201-98-6

3-Methoxy-2-[(3-methylphenyl)methoxy]benzoic acid

Description:

3-Methoxy-2-[(3-methylphenyl)methoxy]benzoic acid, with the CAS number 1142201-98-6, is an organic compound characterized by its complex structure, which includes a benzoic acid core substituted with methoxy and phenyl groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. As a benzoic acid derivative, it may exhibit acidic properties, allowing it to participate in acid-base reactions. Additionally, the presence of the 3-methylphenyl substituent could impart unique steric and electronic effects, potentially affecting its biological activity and interactions with other molecules. Overall, this compound may be of interest in various fields, including pharmaceuticals and materials science, due to its structural features and potential applications. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₆H₁₆O₄

InChI: InChI=1S/C16H16O4/c1-11-5-3-6-12(9-11)10-20-15-13(16(17)18)7-4-8-14(15)19-2/h3-9H,10H2,1-2H3,(H,17,18)

InChI key: InChIKey=NYSPPGFFDAYOEW-UHFFFAOYSA-N

SMILES: O(CC1=CC(C)=CC=C1)C2=C(C(O)=O)C=CC=C2OC

Synonyms:

• 3-Methoxy-2-[(3-methylphenyl)methoxy]benzoic acid
• Benzoic acid, 3-methoxy-2-[(3-methylphenyl)methoxy]-