CAS 1142201-99-7

3-Ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]benzoic acid

Description:

3-Ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]benzoic acid, with the CAS number 1142201-99-7, is a chemical compound characterized by its complex structure, which includes an ethoxy group, a trifluoromethyl-substituted phenyl moiety, and a benzoic acid functional group. This compound is likely to exhibit properties typical of aromatic carboxylic acids, such as moderate solubility in organic solvents and potential acidity due to the carboxylic acid group. The presence of the trifluoromethyl group can enhance lipophilicity and influence the compound's reactivity and biological activity. Additionally, the ethoxy group may contribute to the compound's solubility and stability. Given its structural features, this compound may be of interest in pharmaceutical research, particularly in the development of drugs with specific biological activities. Its unique combination of functional groups suggests potential applications in medicinal chemistry, agrochemicals, or materials science, although specific applications would depend on further empirical studies and evaluations of its properties.

Formula: C₁₇H₁₅F₃O₄

InChI: InChI=1S/C17H15F3O4/c1-2-23-15-9-12(16(21)22)6-7-14(15)24-10-11-4-3-5-13(8-11)17(18,19)20/h3-9H,2,10H2,1H3,(H,21,22)

InChI key: InChIKey=RUNPSBFTTFYTKX-UHFFFAOYSA-N

SMILES: O(CC1=CC(C(F)(F)F)=CC=C1)C2=C(OCC)C=C(C(O)=O)C=C2

Synonyms:

• Benzoic acid, 3-ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]-
• 3-Ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]benzoic acid