CAS 1142202-07-0: 2-Methyl-1-(2-oxiranylmethyl)-1H-indole-3-carboxaldehyde

Description: 2-Methyl-1-(2-oxiranylmethyl)-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a carboxaldehyde functional group indicates that it has an aldehyde moiety, which is typically reactive and can participate in various chemical reactions, such as condensation and oxidation. The "2-oxiranylmethyl" substituent suggests the presence of an epoxide group, which is known for its strain and reactivity, making it a useful intermediate in organic synthesis. The methyl group at the 2-position of the indole ring contributes to the compound's overall hydrophobic character. This compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its unique combination of functional groups and structural elements makes it of interest in medicinal chemistry and synthetic organic chemistry. As with many indole derivatives, it may also possess fluorescent properties, which can be advantageous in various applications, including imaging and sensing.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1S/C13H13NO2/c1-9-12(7-15)11-4-2-3-5-13(11)14(9)6-10-8-16-10/h2-5,7,10H,6,8H2,1H3

InChI key: InChIKey=ODKRYFQSRACIJN-UHFFFAOYSA-N

SMILES: O=CC=1C=2C=CC=CC2N(C1C)CC3OC3

2-methyl-1-(oxiran-2-ylmethyl)-1H-indole-3-carbaldehyde

CAS: 1142202-07-0

• Molecular weight: 215.2519989013672

2-Methyl-1-(oxiran-2-ylmethyl)-1H-indole-3-carbaldehyde

CAS: 1142202-07-0

Please enquire for more information about 2-Methyl-1-(oxiran-2-ylmethyl)-1H-indole-3-carbaldehyde including the price, delivery time and more detailed …

• Formula: C₁₃H₁₃NO₂
• Purity: Min. 95%
• Molecular weight: 215.25 g/mol