CAS 1142202-30-9
:4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3,5-dimethylphenyl)-2-pyrrolidinone
Description:
4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3,5-dimethylphenyl)-2-pyrrolidinone is a chemical compound characterized by its complex structure, which includes a pyrrolidinone ring and a thiadiazole moiety. The presence of the amino group on the thiadiazole contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound features a dimethylphenyl substituent, which may influence its lipophilicity and interaction with biological targets. Its molecular framework suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Additionally, its CAS number, 1142202-30-9, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of such compounds in drug discovery and development.
Formula:C14H16N4OS
InChI:InChI=1S/C14H16N4OS/c1-8-3-9(2)5-11(4-8)18-7-10(6-12(18)19)13-16-17-14(15)20-13/h3-5,10H,6-7H2,1-2H3,(H2,15,17)
InChI key:InChIKey=JCCJKVWNWQTFAB-UHFFFAOYSA-N
SMILES:O=C1N(CC(C1)C=2SC(N)=NN2)C3=CC(C)=CC(C)=C3
Synonyms:- 2-Pyrrolidinone, 4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(3,5-dimethylphenyl)-
- 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3,5-dimethylphenyl)-2-pyrrolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.