CAS 1142202-31-0
:4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-phenyl-2-pyrrolidinone
Description:
4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-phenyl-2-pyrrolidinone is a chemical compound characterized by its unique structural features, which include a pyrrolidinone ring and a thiadiazole moiety. The presence of the amino group on the thiadiazole enhances its potential for biological activity, making it of interest in pharmaceutical research. This compound typically exhibits properties such as moderate solubility in polar solvents and may show varying degrees of stability depending on environmental conditions. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in medicinal chemistry. The compound's CAS number, 1142202-31-0, allows for precise identification and retrieval of information in chemical databases. Overall, the characteristics of this substance position it as a candidate for further investigation in drug development and related fields.
Formula:C12H12N4OS
InChI:InChI=1S/C12H12N4OS/c13-12-15-14-11(18-12)8-6-10(17)16(7-8)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,13,15)
InChI key:InChIKey=HOXZNJCQIUDIGI-UHFFFAOYSA-N
SMILES:O=C1N(CC(C1)C=2SC(N)=NN2)C3=CC=CC=C3
Synonyms:- 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-phenyl-2-pyrrolidinone
- 2-Pyrrolidinone, 4-(5-amino-1,3,4-thiadiazol-2-yl)-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.