CymitQuimica logo

CAS 1142202-34-3

:

4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3,4-dimethylphenyl)-2-pyrrolidinone

Description:
4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3,4-dimethylphenyl)-2-pyrrolidinone is a chemical compound characterized by its unique structural features, which include a pyrrolidinone ring and a thiadiazole moiety. The presence of the amino group on the thiadiazole contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties such as solubility in polar solvents, given the presence of functional groups that can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can interact with biological targets. The compound's specific interactions, stability, and reactivity would depend on its environment, including pH and the presence of other chemical species. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in drug design and development.
Formula:C14H16N4OS
InChI:InChI=1S/C14H16N4OS/c1-8-3-4-11(5-9(8)2)18-7-10(6-12(18)19)13-16-17-14(15)20-13/h3-5,10H,6-7H2,1-2H3,(H2,15,17)
InChI key:InChIKey=ZVEOICMTFYXDAQ-UHFFFAOYSA-N
SMILES:O=C1N(CC(C1)C=2SC(N)=NN2)C3=CC(C)=C(C)C=C3
Synonyms:
  • 2-Pyrrolidinone, 4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(3,4-dimethylphenyl)-
  • 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3,4-dimethylphenyl)-2-pyrrolidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.