CAS 1142202-38-7: 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-ethylphenyl)-2-pyrrolidinone

Description: 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-ethylphenyl)-2-pyrrolidinone is a chemical compound characterized by its unique structural features, which include a pyrrolidinone ring and a thiadiazole moiety. The presence of the amino group on the thiadiazole contributes to its potential biological activity, making it of interest in pharmaceutical research. The ethylphenyl substituent enhances its lipophilicity, which may influence its solubility and permeability properties. This compound may exhibit various pharmacological effects, potentially acting as an antimicrobial or anti-inflammatory agent, although specific biological activities would depend on further empirical studies. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and interaction with biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential in medicinal chemistry.

Formula: C₁₄H₁₆N₄OS

InChI: InChI=1S/C14H16N4OS/c1-2-9-3-5-11(6-4-9)18-8-10(7-12(18)19)13-16-17-14(15)20-13/h3-6,10H,2,7-8H2,1H3,(H2,15,17)

InChI key: InChIKey=YGTGNYWGQHKKRZ-UHFFFAOYSA-N

SMILES: O=C1N(C2=CC=C(C=C2)CC)CC(C3=NN=C(S3)N)C1

4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(4-ethylphenyl)pyrrolidin-2-one

CAS: 1142202-38-7

• Molecular weight: 288.3699951171875

4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-ethylphenyl)pyrrolidin-2-one

CAS: 1142202-38-7

Please enquire for more information about 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-ethylphenyl)pyrrolidin-2-one including the price, delivery time and more detailed …

• Formula: C₁₄H₁₆N₄OS
• Purity: Min. 95%
• Molecular weight: 288.37 g/mol