CAS 1142202-42-3
:4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3-chloro-4-methylphenyl)-2-pyrrolidinone
Description:
4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3-chloro-4-methylphenyl)-2-pyrrolidinone is a chemical compound characterized by its complex structure, which includes a pyrrolidinone ring, a thiadiazole moiety, and a chlorinated aromatic group. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The amino group on the thiadiazole enhances its reactivity and solubility in polar solvents. The chlorinated aromatic substituent may influence the compound's lipophilicity and interaction with biological targets. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can vary depending on the functional groups present. It may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the fields of antimicrobial or anticancer research. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C13H13ClN4OS
InChI:InChI=1S/C13H13ClN4OS/c1-7-2-3-9(5-10(7)14)18-6-8(4-11(18)19)12-16-17-13(15)20-12/h2-3,5,8H,4,6H2,1H3,(H2,15,17)
InChI key:InChIKey=RJTQSULJHIPADR-UHFFFAOYSA-N
SMILES:O=C1N(CC(C1)C=2SC(N)=NN2)C3=CC(Cl)=C(C)C=C3
Synonyms:- 2-Pyrrolidinone, 4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(3-chloro-4-methylphenyl)-
- 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(3-chloro-4-methylphenyl)-2-pyrrolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.