CymitQuimica logo

CAS 1142202-63-8

:

5-[[(3-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid

Description:
5-[[(3-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an amino group, and a propanoic acid moiety. The presence of the methoxyphenyl group contributes to its potential biological activity, as substituents on aromatic rings can influence the compound's interaction with biological targets. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic activities, although specific biological effects would depend on further empirical studies. The thiadiazole ring is known for its diverse pharmacological properties, making this compound of interest in medicinal chemistry. Additionally, the carboxylic acid functional group suggests that it may participate in acid-base reactions, influencing its solubility and reactivity in various environments. Overall, this compound's structural features suggest potential utility in pharmaceutical applications, warranting further investigation into its properties and effects.
Formula:C13H13N3O4S
InChI:InChI=1S/C13H13N3O4S/c1-20-9-4-2-3-8(7-9)14-12(19)13-16-15-10(21-13)5-6-11(17)18/h2-4,7H,5-6H2,1H3,(H,14,19)(H,17,18)
InChI key:InChIKey=WWQUZTZUNMXSCY-UHFFFAOYSA-N
SMILES:C(NC1=CC(OC)=CC=C1)(=O)C=2SC(CCC(O)=O)=NN2
Synonyms:
  • 1,3,4-Thiadiazole-2-propanoic acid, 5-[[(3-methoxyphenyl)amino]carbonyl]-
  • 5-[[(3-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.