CymitQuimica logo

CAS 1142202-72-9

:

5-[[(2-Fluorophenyl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid

Description:
5-[[(2-Fluorophenyl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an amino group, and a propanoic acid moiety. The presence of the fluorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of fluorine on biological activity and lipophilicity. The thiadiazole ring contributes to the compound's heterocyclic nature, which can enhance its reactivity and interaction with biological targets. This compound may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, making it of interest in drug discovery. Its solubility and stability in different solvents can vary, influencing its formulation and application in various chemical contexts. Additionally, the presence of functional groups such as the carboxylic acid can facilitate further chemical modifications, allowing for the synthesis of derivatives with potentially enhanced properties. Overall, this compound represents a class of heterocyclic compounds that are valuable in both research and pharmaceutical applications.
Formula:C12H10FN3O3S
InChI:InChI=1S/C12H10FN3O3S/c13-7-3-1-2-4-8(7)14-11(19)12-16-15-9(20-12)5-6-10(17)18/h1-4H,5-6H2,(H,14,19)(H,17,18)
InChI key:InChIKey=HWFNZIFXIBXUQY-UHFFFAOYSA-N
SMILES:C(NC1=C(F)C=CC=C1)(=O)C=2SC(CCC(O)=O)=NN2
Synonyms:
  • 5-[[(2-Fluorophenyl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid
  • 1,3,4-Thiadiazole-2-propanoic acid, 5-[[(2-fluorophenyl)amino]carbonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.