CymitQuimica logo

CAS 1142202-73-0

:

1-[[5-[[(4-Methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid

Description:
1-[[5-[[(4-Methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid is a complex organic compound characterized by its multi-functional structure, which includes a piperidine ring, a thiadiazole moiety, and an amide linkage. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The thiadiazole group is known for its diverse applications in medicinal chemistry, particularly for its antimicrobial and anti-inflammatory properties. The compound's structure suggests it may exhibit significant interactions with biological targets, making it of interest in drug development. Additionally, the presence of the 4-methylphenyl group may enhance lipophilicity, influencing its pharmacokinetic properties. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further investigation in medicinal chemistry and related fields. However, specific properties such as solubility, stability, and reactivity would require empirical data for comprehensive characterization.
Formula:C17H18N4O4S
InChI:InChI=1S/C17H18N4O4S/c1-10-4-6-12(7-5-10)18-13(22)14-19-20-15(26-14)16(23)21-8-2-3-11(9-21)17(24)25/h4-7,11H,2-3,8-9H2,1H3,(H,18,22)(H,24,25)
InChI key:InChIKey=CGPQJYDKNPAQEB-UHFFFAOYSA-N
SMILES:C(=O)(C=1SC(C(NC2=CC=C(C)C=C2)=O)=NN1)N3CC(C(O)=O)CCC3
Synonyms:
  • 1-[[5-[[(4-Methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
  • 3-Piperidinecarboxylic acid, 1-[[5-[[(4-methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.