CAS 1142202-73-0: 1-[[5-[[(4-Methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
Description:1-[[5-[[(4-Methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid is a complex organic compound characterized by its multi-functional structure, which includes a piperidine ring, a thiadiazole moiety, and an amide linkage. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The thiadiazole group is known for its diverse applications in medicinal chemistry, particularly for its antimicrobial and anti-inflammatory properties. The compound's structure suggests it may exhibit significant interactions with biological targets, making it of interest in drug development. Additionally, the presence of the 4-methylphenyl group may enhance lipophilicity, influencing its pharmacokinetic properties. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further investigation in medicinal chemistry and related fields. However, specific properties such as solubility, stability, and reactivity would require empirical data for comprehensive characterization.
Formula:C17H18N4O4S
InChI:InChI=1S/C17H18N4O4S/c1-10-4-6-12(7-5-10)18-13(22)14-19-20-15(26-14)16(23)21-8-2-3-11(9-21)17(24)25/h4-7,11H,2-3,8-9H2,1H3,(H,18,22)(H,24,25)
InChI key:InChIKey=CGPQJYDKNPAQEB-UHFFFAOYSA-N
SMILES:O=C(O)C1CN(C(=O)C2=NN=C(S2)C(=O)NC3=CC=C(C=C3)C)CCC1
- Synonyms:
- 1-[[5-[[(4-Methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
- 3-Piperidinecarboxylic acid, 1-[[5-[[(4-methylphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-[(5-{[(4-methylphenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)carbonyl]piperidine-3-carboxylic acid REF: 10-F367750CAS: 1142202-73-0 | - - - | - - - | Discontinued product |
![]() | 1-[(5-{[(4-Methylphenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)carbonyl]piperidine-3-carboxylic acid REF: 3D-FM119555CAS: 1142202-73-0 | Min. 95% | - - - | Discontinued product |

1-[(5-{[(4-methylphenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)carbonyl]piperidine-3-carboxylic acid
Ref: 10-F367750
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

1-[(5-{[(4-Methylphenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)carbonyl]piperidine-3-carboxylic acid
Ref: 3D-FM119555
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |