CAS 1142202-78-5

2-[[5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid

Description:

2-[[5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid is a chemical compound characterized by its complex structure, which includes a thiadiazole ring, a methoxy group, and an acetic acid moiety. The presence of the thiadiazole ring suggests potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The methoxyphenyl group may enhance lipophilicity and influence the compound's interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic and polar functional groups. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The acetic acid component may contribute to its acidity and influence its behavior in biological systems. Overall, this compound's unique combination of functional groups positions it as a candidate for further research in drug development and related fields.

Formula: C₁₃H₁₃N₃O₅S

InChI: InChI=1S/C13H13N3O5S/c1-20-9-4-2-8(3-5-9)14-12(19)13-16-15-10(22-13)6-21-7-11(17)18/h2-5H,6-7H2,1H3,(H,14,19)(H,17,18)

InChI key: InChIKey=MYYOSANFGDVIKO-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(OC)C=C1)(=O)C=2SC(COCC(O)=O)=NN2

Synonyms:

• 2-[[5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid
• Acetic acid, 2-[[5-[[(4-methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]-